C17H18N2O4 — CID 2892957
methyl 6-amino-5-cyano-4-(2-ethoxyphenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 2892957) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is methyl 6-amino-5-cyano-4-(2-ethoxyphenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | methyl 6-amino-5-cyano-4-(2-ethoxyphenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 2892957 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methyl 6-amino-5-cyano-4-(2-ethoxyphenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOc1ccccc1C1C(C#N)=C(N)OC(C)=C1C(=O)OC |
| InChI | InChI=1S/C17H18N2O4/c1-4-22-13-8-6-5-7-11(13)15-12(9-18)16(19)23-10(2)14(15)17(20)21-3/h5-8,15H,4,19H2,1-3H3 |
| InChIKey | MLOABMRKDMDLAO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |