C25H23ClN2O6 — CID 169391856
ethyl 6-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169391856) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is ethyl 6-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169391856 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 6-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(OC(=O)c2ccccc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C25H23ClN2O6/c1-4-31-20-12-15(10-11-19(20)34-24(29)16-8-6-7-9-18(16)26)22-17(13-27)23(28)33-14(3)21(22)25(30)32-5-2/h6-12,22H,4-5,28H2,1-3H3 |
| InChIKey | ZPCSXJZXEPJXLT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|