C15H16N3O2+ — CID 40534664
(4S)-5-acetyl-2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile (PubChem CID 40534664) has the molecular formula C15H16N3O2+ and a molecular weight of 270.31 g/mol. Its IUPAC name is (4S)-5-acetyl-2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile.
| Compound Name | (4S)-5-acetyl-2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 40534664 |
| Molecular Formula | C15H16N3O2+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (4S)-5-acetyl-2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)[C@@H]1c1ccc[n+](C)c1 |
| InChI | InChI=1S/C15H16N3O2/c1-9(19)13-10(2)20-15(17)12(7-16)14(13)11-5-4-6-18(3)8-11/h4-6,8,14H,17H2,1-3H3/q+1/t14-/m0/s1 |
| InChIKey | SOKJUVNKLIKCHD-AWEZNQCLSA-N |
| XLogP | 1.18 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|