C16H14N3O2+ — CID 915024
(4S)-2-amino-7-hydroxy-4-(1-methylpyridin-1-ium-3-yl)-4H-chromene-3-carbonitrile (PubChem CID 915024) has the molecular formula C16H14N3O2+ and a molecular weight of 280.31 g/mol. Its IUPAC name is (4S)-2-amino-7-hydroxy-4-(1-methylpyridin-1-ium-3-yl)-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-7-hydroxy-4-(1-methylpyridin-1-ium-3-yl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 915024 |
| Molecular Formula | C16H14N3O2+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (4S)-2-amino-7-hydroxy-4-(1-methylpyridin-1-ium-3-yl)-4H-chromene-3-carbonitrile |
| SMILES | C[n+]1cccc([C@@H]2C(C#N)=C(N)Oc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C16H13N3O2/c1-19-6-2-3-10(9-19)15-12-5-4-11(20)7-14(12)21-16(18)13(15)8-17/h2-7,9,15H,18H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | AMQUDMQMKDSIKA-HNNXBMFYSA-O |
| XLogP | 1.43 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|