C14H10N2O2S — CID 2837584
2-amino-7-hydroxy-4-thiophen-3-yl-4H-chromene-3-carbonitrile (PubChem CID 2837584) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-amino-7-hydroxy-4-thiophen-3-yl-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-7-hydroxy-4-thiophen-3-yl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2837584 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-amino-7-hydroxy-4-thiophen-3-yl-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)ccc2C1c1ccsc1 |
| InChI | InChI=1S/C14H10N2O2S/c15-6-11-13(8-3-4-19-7-8)10-2-1-9(17)5-12(10)18-14(11)16/h1-5,7,13,17H,16H2 |
| InChIKey | NUYFOGNMWHRFDS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |