C14H11N3OS — CID 2839508
2,7-diamino-4-thiophen-3-yl-4H-chromene-3-carbonitrile (PubChem CID 2839508) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 2,7-diamino-4-thiophen-3-yl-4H-chromene-3-carbonitrile.
| Compound Name | 2,7-diamino-4-thiophen-3-yl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2839508 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2,7-diamino-4-thiophen-3-yl-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2C1c1ccsc1 |
| InChI | InChI=1S/C14H11N3OS/c15-6-11-13(8-3-4-19-7-8)10-2-1-9(16)5-12(10)18-14(11)17/h1-5,7,13H,16-17H2 |
| InChIKey | PHLLNPFXPWAUAC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|