C19H19N3O2 — CID 40841877
(4R)-2,7-diamino-4-(4-propoxyphenyl)-4H-chromene-3-carbonitrile (PubChem CID 40841877) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is (4R)-2,7-diamino-4-(4-propoxyphenyl)-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2,7-diamino-4-(4-propoxyphenyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 40841877 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (4R)-2,7-diamino-4-(4-propoxyphenyl)-4H-chromene-3-carbonitrile |
| SMILES | CCCOc1ccc([C@H]2C(C#N)=C(N)Oc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-2-9-23-14-6-3-12(4-7-14)18-15-8-5-13(21)10-17(15)24-19(22)16(18)11-20/h3-8,10,18H,2,9,21-22H2,1H3/t18-/m1/s1 |
| InChIKey | LPKINYKRPQAVBE-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|