C20H21N3O — CID 40841853
(4R)-2,7-diamino-4-(4-tert-butylphenyl)-4H-chromene-3-carbonitrile (PubChem CID 40841853) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (4R)-2,7-diamino-4-(4-tert-butylphenyl)-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2,7-diamino-4-(4-tert-butylphenyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 40841853 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (4R)-2,7-diamino-4-(4-tert-butylphenyl)-4H-chromene-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc([C@H]2C(C#N)=C(N)Oc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-20(2,3)13-6-4-12(5-7-13)18-15-9-8-14(22)10-17(15)24-19(23)16(18)11-21/h4-10,18H,22-23H2,1-3H3/t18-/m1/s1 |
| InChIKey | GKTUCVTYONXOFC-GOSISDBHSA-N |
| XLogP | 3.78 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|