C15H12N4O — CID 749457
(4S)-2,7-diamino-4-pyridin-4-yl-4H-chromene-3-carbonitrile (PubChem CID 749457) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is (4S)-2,7-diamino-4-pyridin-4-yl-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2,7-diamino-4-pyridin-4-yl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 749457 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (4S)-2,7-diamino-4-pyridin-4-yl-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C15H12N4O/c16-8-12-14(9-3-5-19-6-4-9)11-2-1-10(17)7-13(11)20-15(12)18/h1-7,14H,17-18H2/t14-/m0/s1 |
| InChIKey | UBSXLRNZVVIGMQ-AWEZNQCLSA-N |
| XLogP | 1.88 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|