C16H12IN3O — CID 1243366
(4S)-2,7-diamino-4-(3-iodophenyl)-4H-chromene-3-carbonitrile (PubChem CID 1243366) has the molecular formula C16H12IN3O and a molecular weight of 389.20 g/mol. Its IUPAC name is (4S)-2,7-diamino-4-(3-iodophenyl)-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2,7-diamino-4-(3-iodophenyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1243366 |
| Molecular Formula | C16H12IN3O |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | (4S)-2,7-diamino-4-(3-iodophenyl)-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2[C@@H]1c1cccc(I)c1 |
| InChI | InChI=1S/C16H12IN3O/c17-10-3-1-2-9(6-10)15-12-5-4-11(19)7-14(12)21-16(20)13(15)8-18/h1-7,15H,19-20H2/t15-/m0/s1 |
| InChIKey | AMECHKAAVNHNBQ-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|