C16H11Cl2N3O — CID 2838875
2,7-diamino-4-(3,4-dichlorophenyl)-4H-chromene-3-carbonitrile (PubChem CID 2838875) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2,7-diamino-4-(3,4-dichlorophenyl)-4H-chromene-3-carbonitrile.
| Compound Name | 2,7-diamino-4-(3,4-dichlorophenyl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2838875 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2,7-diamino-4-(3,4-dichlorophenyl)-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3O/c17-12-4-1-8(5-13(12)18)15-10-3-2-9(20)6-14(10)22-16(21)11(15)7-19/h1-6,15H,20-21H2 |
| InChIKey | LXDDESPTIKXBJI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|