C20H13Cl2N3O2 — CID 40841906
(4S)-2,7-diamino-4-[5-(3,4-dichlorophenyl)furan-2-yl]-4H-chromene-3-carbonitrile (PubChem CID 40841906) has the molecular formula C20H13Cl2N3O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is (4S)-2,7-diamino-4-[5-(3,4-dichlorophenyl)furan-2-yl]-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2,7-diamino-4-[5-(3,4-dichlorophenyl)furan-2-yl]-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 40841906 |
| Molecular Formula | C20H13Cl2N3O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (4S)-2,7-diamino-4-[5-(3,4-dichlorophenyl)furan-2-yl]-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2[C@@H]1c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H13Cl2N3O2/c21-14-4-1-10(7-15(14)22)16-5-6-17(26-16)19-12-3-2-11(24)8-18(12)27-20(25)13(19)9-23/h1-8,19H,24-25H2/t19-/m0/s1 |
| InChIKey | XQWUMHLUJXODRH-IBGZPJMESA-N |
| XLogP | 5.05 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|