C16H19N3O — CID 717008
(4S)-2,7-diamino-4-cyclohexyl-4H-chromene-3-carbonitrile (PubChem CID 717008) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (4S)-2,7-diamino-4-cyclohexyl-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2,7-diamino-4-cyclohexyl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 717008 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (4S)-2,7-diamino-4-cyclohexyl-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(N)ccc2[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C16H19N3O/c17-9-13-15(10-4-2-1-3-5-10)12-7-6-11(18)8-14(12)20-16(13)19/h6-8,10,15H,1-5,18-19H2/t15-/m0/s1 |
| InChIKey | OJXRMPFEXKGUOL-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|