C21H17ClN4O — CID 3168011
2,7-diamino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-chromene-3-carbonitrile (PubChem CID 3168011) has the molecular formula C21H17ClN4O and a molecular weight of 376.85 g/mol. Its IUPAC name is 2,7-diamino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-chromene-3-carbonitrile.
| Compound Name | 2,7-diamino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3168011 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2,7-diamino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-chromene-3-carbonitrile |
| SMILES | Cc1cc(C)c2cc(C3C(C#N)=C(N)Oc4cc(N)ccc43)c(Cl)nc2c1 |
| InChI | InChI=1S/C21H17ClN4O/c1-10-5-11(2)14-8-15(20(22)26-17(14)6-10)19-13-4-3-12(24)7-18(13)27-21(25)16(19)9-23/h3-8,19H,24-25H2,1-2H3 |
| InChIKey | QDPIBKRGPIMYQS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|