C25H18ClN3O — CID 1076883
(4R)-2-amino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 1076883) has the molecular formula C25H18ClN3O and a molecular weight of 411.89 g/mol. Its IUPAC name is (4R)-2-amino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1076883 |
| Molecular Formula | C25H18ClN3O |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (4R)-2-amino-4-(2-chloro-5,7-dimethylquinolin-3-yl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | Cc1cc(C)c2cc([C@H]3C(C#N)=C(N)Oc4c3ccc3ccccc43)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H18ClN3O/c1-13-9-14(2)18-11-19(24(26)29-21(18)10-13)22-17-8-7-15-5-3-4-6-16(15)23(17)30-25(28)20(22)12-27/h3-11,22H,28H2,1-2H3/t22-/m0/s1 |
| InChIKey | REGAGINRSYAWET-QFIPXVFZSA-N |
| XLogP | 5.88 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|