C20H13FN2O — CID 2303203
(4R)-2-amino-4-(2-fluorophenyl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 2303203) has the molecular formula C20H13FN2O and a molecular weight of 316.34 g/mol. Its IUPAC name is (4R)-2-amino-4-(2-fluorophenyl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(2-fluorophenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2303203 |
| Molecular Formula | C20H13FN2O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (4R)-2-amino-4-(2-fluorophenyl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(ccc3ccccc23)[C@H]1c1ccccc1F |
| InChI | InChI=1S/C20H13FN2O/c21-17-8-4-3-7-14(17)18-15-10-9-12-5-1-2-6-13(12)19(15)24-20(23)16(18)11-22/h1-10,18H,23H2/t18-/m1/s1 |
| InChIKey | MKFPLLMYQADGKH-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |