C23H15BrN2O2 — CID 3296979
2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 3296979) has the molecular formula C23H15BrN2O2 and a molecular weight of 431.29 g/mol. Its IUPAC name is 2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3296979 |
| Molecular Formula | C23H15BrN2O2 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2-amino-4-(5-bromo-2-prop-2-ynoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | C#CCOc1ccc(Br)cc1C1C(C#N)=C(N)Oc2c1ccc1ccccc21 |
| InChI | InChI=1S/C23H15BrN2O2/c1-2-11-27-20-10-8-15(24)12-18(20)21-17-9-7-14-5-3-4-6-16(14)22(17)28-23(26)19(21)13-25/h1,3-10,12,21H,11,26H2 |
| InChIKey | OGAXBYPOPQRRBM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|