C22H17BrN2O3 — CID 41316981
(4S)-2-amino-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 41316981) has the molecular formula C22H17BrN2O3 and a molecular weight of 437.29 g/mol. Its IUPAC name is (4S)-2-amino-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 41316981 |
| Molecular Formula | C22H17BrN2O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | (4S)-2-amino-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | CCOc1cc([C@@H]2C(C#N)=C(N)Oc3c2ccc2ccccc32)cc(Br)c1O |
| InChI | InChI=1S/C22H17BrN2O3/c1-2-27-18-10-13(9-17(23)20(18)26)19-15-8-7-12-5-3-4-6-14(12)21(15)28-22(25)16(19)11-24/h3-10,19,26H,2,25H2,1H3/t19-/m0/s1 |
| InChIKey | GXYOSCUBDAELKA-IBGZPJMESA-N |
| XLogP | 4.92 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |