C22H18N2O3 — CID 1378092
(4R)-2-amino-4-(2,3-dimethoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 1378092) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (4R)-2-amino-4-(2,3-dimethoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(2,3-dimethoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 1378092 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (4R)-2-amino-4-(2,3-dimethoxyphenyl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | COc1cccc([C@@H]2C(C#N)=C(N)Oc3c2ccc2ccccc32)c1OC |
| InChI | InChI=1S/C22H18N2O3/c1-25-18-9-5-8-15(21(18)26-2)19-16-11-10-13-6-3-4-7-14(13)20(16)27-22(24)17(19)12-23/h3-11,19H,24H2,1-2H3/t19-/m0/s1 |
| InChIKey | PKIADWKSEGXCLC-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |