C34H28N4O6 — CID 162788079
3,9-diamino-1,7-bis(2,3-dimethoxyphenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarbonitrile (PubChem CID 162788079) has the molecular formula C34H28N4O6 and a molecular weight of 588.62 g/mol. Its IUPAC name is 3,9-diamino-1,7-bis(2,3-dimethoxyphenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarbonitrile.
| Compound Name | 3,9-diamino-1,7-bis(2,3-dimethoxyphenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarbonitrile |
|---|---|
| PubChem CID | 162788079 |
| Molecular Formula | C34H28N4O6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3,9-diamino-1,7-bis(2,3-dimethoxyphenyl)-1,7-dihydrochromeno[8,7-h]chromene-2,8-dicarbonitrile |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3c2ccc2c4c(ccc32)C(c2cccc(OC)c2OC)C(C#N)=C(N)O4)c1OC |
| InChI | InChI=1S/C34H28N4O6/c1-39-25-9-5-7-19(31(25)41-3)27-21-13-11-18-17(29(21)43-33(37)23(27)15-35)12-14-22-28(24(16-36)34(38)44-30(18)22)20-8-6-10-26(40-2)32(20)42-4/h5-14,27-28H,37-38H2,1-4H3 |
| InChIKey | HHACXICJPHPPHD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |