C25H18N2O5 — CID 139224540
4-amino-6-(2,3-dimethoxyphenyl)-8-oxo-3,9-dioxatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile (PubChem CID 139224540) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-amino-6-(2,3-dimethoxyphenyl)-8-oxo-3,9-dioxatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile.
| Compound Name | 4-amino-6-(2,3-dimethoxyphenyl)-8-oxo-3,9-dioxatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile |
|---|---|
| PubChem CID | 139224540 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-amino-6-(2,3-dimethoxyphenyl)-8-oxo-3,9-dioxatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),4,11,13,15,17-heptaene-5-carbonitrile |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3c2c(=O)oc2c3ccc3ccccc32)c1OC |
| InChI | InChI=1S/C25H18N2O5/c1-29-18-9-5-8-15(22(18)30-2)19-17(12-26)24(27)31-23-16-11-10-13-6-3-4-7-14(13)21(16)32-25(28)20(19)23/h3-11,19H,27H2,1-2H3 |
| InChIKey | ZGUHWIJLVSVECW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|