C20H16N2O3S — CID 2348099
(4S)-2-amino-4-(2,3-dimethoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile (PubChem CID 2348099) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is (4S)-2-amino-4-(2,3-dimethoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(2,3-dimethoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 2348099 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (4S)-2-amino-4-(2,3-dimethoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
| SMILES | COc1cccc([C@H]2C(C#N)=C(N)Oc3c2sc2ccccc32)c1OC |
| InChI | InChI=1S/C20H16N2O3S/c1-23-14-8-5-7-12(17(14)24-2)16-13(10-21)20(22)25-18-11-6-3-4-9-15(11)26-19(16)18/h3-9,16H,22H2,1-2H3/t16-/m0/s1 |
| InChIKey | JJINIHXCTMNGQD-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|