C20H17N3OS — CID 3153376
2-amino-4-[4-(dimethylamino)phenyl]-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile (PubChem CID 3153376) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-amino-4-[4-(dimethylamino)phenyl]-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile.
| Compound Name | 2-amino-4-[4-(dimethylamino)phenyl]-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 3153376 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-amino-4-[4-(dimethylamino)phenyl]-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
| SMILES | CN(C)c1ccc(C2C(C#N)=C(N)Oc3c2sc2ccccc32)cc1 |
| InChI | InChI=1S/C20H17N3OS/c1-23(2)13-9-7-12(8-10-13)17-15(11-21)20(22)24-18-14-5-3-4-6-16(14)25-19(17)18/h3-10,17H,22H2,1-2H3 |
| InChIKey | FYLKDLWGTPJDAW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|