C24H16N2O2S — CID 2348106
(4R)-2-amino-4-(3-phenoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile (PubChem CID 2348106) has the molecular formula C24H16N2O2S and a molecular weight of 396.47 g/mol. Its IUPAC name is (4R)-2-amino-4-(3-phenoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-(3-phenoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 2348106 |
| Molecular Formula | C24H16N2O2S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (4R)-2-amino-4-(3-phenoxyphenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(sc3ccccc23)[C@@H]1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H16N2O2S/c25-14-19-21(15-7-6-10-17(13-15)27-16-8-2-1-3-9-16)23-22(28-24(19)26)18-11-4-5-12-20(18)29-23/h1-13,21H,26H2/t21-/m1/s1 |
| InChIKey | ZQQZJBCVJQRTTK-OAQYLSRUSA-N |
| XLogP | 5.91 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|