C19H12N2O2S — CID 4915894
2-amino-5-oxo-4-phenyl-4H-thiochromeno[4,3-b]pyran-3-carbonitrile (PubChem CID 4915894) has the molecular formula C19H12N2O2S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-amino-5-oxo-4-phenyl-4H-thiochromeno[4,3-b]pyran-3-carbonitrile.
| Compound Name | 2-amino-5-oxo-4-phenyl-4H-thiochromeno[4,3-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 4915894 |
| Molecular Formula | C19H12N2O2S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-amino-5-oxo-4-phenyl-4H-thiochromeno[4,3-b]pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(=O)sc3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C19H12N2O2S/c20-10-13-15(11-6-2-1-3-7-11)16-17(23-18(13)21)12-8-4-5-9-14(12)24-19(16)22/h1-9,15H,21H2 |
| InChIKey | SBUUBQBLDUKLQY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |