C18H10BrClN2OS — CID 155813563
2-amino-6-bromo-4-(4-chlorophenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile (PubChem CID 155813563) has the molecular formula C18H10BrClN2OS and a molecular weight of 417.72 g/mol. Its IUPAC name is 2-amino-6-bromo-4-(4-chlorophenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile.
| Compound Name | 2-amino-6-bromo-4-(4-chlorophenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 155813563 |
| Molecular Formula | C18H10BrClN2OS |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 2-amino-6-bromo-4-(4-chlorophenyl)-4H-[1]benzothiolo[3,2-b]pyran-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(sc3c(Br)cccc23)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H10BrClN2OS/c19-13-3-1-2-11-15-17(24-16(11)13)14(12(8-21)18(22)23-15)9-4-6-10(20)7-5-9/h1-7,14H,22H2 |
| InChIKey | BDVVITYPUUGYJO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|