C20H12Cl2N2O — CID 134876103
2-amino-6-chloro-4-(4-chlorophenyl)-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 134876103) has the molecular formula C20H12Cl2N2O and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-amino-6-chloro-4-(4-chlorophenyl)-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 2-amino-6-chloro-4-(4-chlorophenyl)-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 134876103 |
| Molecular Formula | C20H12Cl2N2O |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-amino-6-chloro-4-(4-chlorophenyl)-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(cc(Cl)c3ccccc23)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O/c21-12-7-5-11(6-8-12)18-15-9-17(22)13-3-1-2-4-14(13)19(15)25-20(24)16(18)10-23/h1-9,18H,24H2 |
| InChIKey | ZNZNDJHEQVTQMZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |