C28H18Cl2N2O2 — CID 11812898
6-chloro-4-(4-chlorophenyl)-2-[(E)-(4-methoxyphenyl)methylideneamino]-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 11812898) has the molecular formula C28H18Cl2N2O2 and a molecular weight of 485.37 g/mol. Its IUPAC name is 6-chloro-4-(4-chlorophenyl)-2-[(E)-(4-methoxyphenyl)methylideneamino]-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 6-chloro-4-(4-chlorophenyl)-2-[(E)-(4-methoxyphenyl)methylideneamino]-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 11812898 |
| Molecular Formula | C28H18Cl2N2O2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 6-chloro-4-(4-chlorophenyl)-2-[(E)-(4-methoxyphenyl)methylideneamino]-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | COc1ccc(/C=N/C2=C(C#N)C(c3ccc(Cl)cc3)c3cc(Cl)c4ccccc4c3O2)cc1 |
| InChI | InChI=1S/C28H18Cl2N2O2/c1-33-20-12-6-17(7-13-20)16-32-28-24(15-31)26(18-8-10-19(29)11-9-18)23-14-25(30)21-4-2-3-5-22(21)27(23)34-28/h2-14,16,26H,1H3/b32-16+ |
| InChIKey | GWLDNJVJEPEQEI-KPGMTVGESA-N |
| XLogP | 7.53 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|