C25H21N3O — CID 69001597
2-(benzylideneamino)-7-(dimethylamino)-4-phenyl-4H-chromene-3-carbonitrile (PubChem CID 69001597) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(benzylideneamino)-7-(dimethylamino)-4-phenyl-4H-chromene-3-carbonitrile.
| Compound Name | 2-(benzylideneamino)-7-(dimethylamino)-4-phenyl-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 69001597 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-(benzylideneamino)-7-(dimethylamino)-4-phenyl-4H-chromene-3-carbonitrile |
| SMILES | CN(C)c1ccc2c(c1)OC(N=Cc1ccccc1)=C(C#N)C2c1ccccc1 |
| InChI | InChI=1S/C25H21N3O/c1-28(2)20-13-14-21-23(15-20)29-25(27-17-18-9-5-3-6-10-18)22(16-26)24(21)19-11-7-4-8-12-19/h3-15,17,24H,1-2H3 |
| InChIKey | BJJOZKHNDSTFJX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|