C23H25ClN4O — CID 51039561
N'-[4-(4-chlorophenyl)-3-cyano-7-(diethylamino)-4H-chromen-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 51039561) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)-3-cyano-7-(diethylamino)-4H-chromen-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(4-chlorophenyl)-3-cyano-7-(diethylamino)-4H-chromen-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 51039561 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N'-[4-(4-chlorophenyl)-3-cyano-7-(diethylamino)-4H-chromen-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCN(CC)c1ccc2c(c1)OC(/N=C/N(C)C)=C(C#N)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClN4O/c1-5-28(6-2)18-11-12-19-21(13-18)29-23(26-15-27(3)4)20(14-25)22(19)16-7-9-17(24)10-8-16/h7-13,15,22H,5-6H2,1-4H3/b26-15+ |
| InChIKey | TXRZNLGURJQSPC-CVKSISIWSA-N |
| XLogP | 5.04 |
| TPSA | 51.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|