C23H16ClFN2O2 — CID 19101023
ethyl (1E)-N-[4-(3-chloro-4-fluorophenyl)-3-cyano-4H-benzo[h]chromen-2-yl]methanimidate (PubChem CID 19101023) has the molecular formula C23H16ClFN2O2 and a molecular weight of 406.84 g/mol. Its IUPAC name is ethyl (1E)-N-[4-(3-chloro-4-fluorophenyl)-3-cyano-4H-benzo[h]chromen-2-yl]methanimidate.
| Compound Name | ethyl (1E)-N-[4-(3-chloro-4-fluorophenyl)-3-cyano-4H-benzo[h]chromen-2-yl]methanimidate |
|---|---|
| PubChem CID | 19101023 |
| Molecular Formula | C23H16ClFN2O2 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | ethyl (1E)-N-[4-(3-chloro-4-fluorophenyl)-3-cyano-4H-benzo[h]chromen-2-yl]methanimidate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccc(F)c(Cl)c2)c2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C23H16ClFN2O2/c1-2-28-13-27-23-18(12-26)21(15-8-10-20(25)19(24)11-15)17-9-7-14-5-3-4-6-16(14)22(17)29-23/h3-11,13,21H,2H2,1H3/b27-13+ |
| InChIKey | BIDNZFNEGXAUNB-UVHMKAGCSA-N |
| XLogP | 5.96 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|