C23H18ClN3O3 — CID 165111952
ethyl (1E)-N-[4-(4-chlorophenyl)-3-cyano-8-methyl-5-oxo-4,6-dihydropyrano[3,2-c]quinolin-2-yl]methanimidate (PubChem CID 165111952) has the molecular formula C23H18ClN3O3 and a molecular weight of 419.87 g/mol. Its IUPAC name is ethyl (1E)-N-[4-(4-chlorophenyl)-3-cyano-8-methyl-5-oxo-4,6-dihydropyrano[3,2-c]quinolin-2-yl]methanimidate.
| Compound Name | ethyl (1E)-N-[4-(4-chlorophenyl)-3-cyano-8-methyl-5-oxo-4,6-dihydropyrano[3,2-c]quinolin-2-yl]methanimidate |
|---|---|
| PubChem CID | 165111952 |
| Molecular Formula | C23H18ClN3O3 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | ethyl (1E)-N-[4-(4-chlorophenyl)-3-cyano-8-methyl-5-oxo-4,6-dihydropyrano[3,2-c]quinolin-2-yl]methanimidate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccc(Cl)cc2)c2c(c3ccc(C)cc3[nH]c2=O)O1 |
| InChI | InChI=1S/C23H18ClN3O3/c1-3-29-12-26-23-17(11-25)19(14-5-7-15(24)8-6-14)20-21(30-23)16-9-4-13(2)10-18(16)27-22(20)28/h4-10,12,19H,3H2,1-2H3,(H,27,28)/b26-12+ |
| InChIKey | KYNUQMZZXZXGSJ-RPPGKUMJSA-N |
| XLogP | 4.81 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|