C19H19ClN2O4 — CID 102552216
ethyl 2-(chloromethyl)-5-cyano-6-[(E)-ethoxymethylideneamino]-4-phenyl-4H-pyran-3-carboxylate (PubChem CID 102552216) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-5-cyano-6-[(E)-ethoxymethylideneamino]-4-phenyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 2-(chloromethyl)-5-cyano-6-[(E)-ethoxymethylideneamino]-4-phenyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 102552216 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | ethyl 2-(chloromethyl)-5-cyano-6-[(E)-ethoxymethylideneamino]-4-phenyl-4H-pyran-3-carboxylate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccccc2)C(C(=O)OCC)=C(CCl)O1 |
| InChI | InChI=1S/C19H19ClN2O4/c1-3-24-12-22-18-14(11-21)16(13-8-6-5-7-9-13)17(15(10-20)26-18)19(23)25-4-2/h5-9,12,16H,3-4,10H2,1-2H3/b22-12+ |
| InChIKey | VAEGZCAOSHVGRO-WSDLNYQXSA-N |
| XLogP | 3.66 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|