C23H20N2O4 — CID 12858633
ethyl 2-acetamido-5-cyano-4,6-diphenyl-4H-pyran-3-carboxylate (PubChem CID 12858633) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 2-acetamido-5-cyano-4,6-diphenyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 2-acetamido-5-cyano-4,6-diphenyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 12858633 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | ethyl 2-acetamido-5-cyano-4,6-diphenyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(NC(C)=O)OC(c2ccccc2)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C23H20N2O4/c1-3-28-23(27)20-19(16-10-6-4-7-11-16)18(14-24)21(17-12-8-5-9-13-17)29-22(20)25-15(2)26/h4-13,19H,3H2,1-2H3,(H,25,26) |
| InChIKey | FXJMAVRQHLCSOI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |