C24H19BrN2O3 — CID 10928686
ethyl (1E)-N-[8-bromo-2-cyano-1-(4-methoxyphenyl)-1H-benzo[f]chromen-3-yl]methanimidate (PubChem CID 10928686) has the molecular formula C24H19BrN2O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is ethyl (1E)-N-[8-bromo-2-cyano-1-(4-methoxyphenyl)-1H-benzo[f]chromen-3-yl]methanimidate.
| Compound Name | ethyl (1E)-N-[8-bromo-2-cyano-1-(4-methoxyphenyl)-1H-benzo[f]chromen-3-yl]methanimidate |
|---|---|
| PubChem CID | 10928686 |
| Molecular Formula | C24H19BrN2O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | ethyl (1E)-N-[8-bromo-2-cyano-1-(4-methoxyphenyl)-1H-benzo[f]chromen-3-yl]methanimidate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccc(OC)cc2)c2c(ccc3cc(Br)ccc23)O1 |
| InChI | InChI=1S/C24H19BrN2O3/c1-3-29-14-27-24-20(13-26)22(15-4-8-18(28-2)9-5-15)23-19-10-7-17(25)12-16(19)6-11-21(23)30-24/h4-12,14,22H,3H2,1-2H3/b27-14+ |
| InChIKey | PKLCFSTZJNRXKE-MZJWZYIUSA-N |
| XLogP | 5.94 |
| TPSA | 63.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|