C20H13BrN2O4 — CID 146595442
2-amino-4-(4-bromophenyl)-8-methoxy-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 146595442) has the molecular formula C20H13BrN2O4 and a molecular weight of 425.24 g/mol. Its IUPAC name is 2-amino-4-(4-bromophenyl)-8-methoxy-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(4-bromophenyl)-8-methoxy-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 146595442 |
| Molecular Formula | C20H13BrN2O4 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 2-amino-4-(4-bromophenyl)-8-methoxy-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)C(c1ccc(Br)cc1)C(C#N)=C(N)O3 |
| InChI | InChI=1S/C20H13BrN2O4/c1-25-12-6-7-13-15(8-12)26-20(24)17-16(10-2-4-11(21)5-3-10)14(9-22)19(23)27-18(13)17/h2-8,16H,23H2,1H3 |
| InChIKey | LLUWBFIFUQUMTB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|