C25H17N3O4 — CID 142491728
2-amino-9-methoxy-5-oxo-4-(4-pyridin-3-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491728) has the molecular formula C25H17N3O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-amino-9-methoxy-5-oxo-4-(4-pyridin-3-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-9-methoxy-5-oxo-4-(4-pyridin-3-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491728 |
| Molecular Formula | C25H17N3O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-amino-9-methoxy-5-oxo-4-(4-pyridin-3-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1ccc2oc(=O)c3c(c2c1)OC(N)=C(C#N)C3c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C25H17N3O4/c1-30-17-8-9-20-18(11-17)23-22(25(29)31-20)21(19(12-26)24(27)32-23)15-6-4-14(5-7-15)16-3-2-10-28-13-16/h2-11,13,21H,27H2,1H3 |
| InChIKey | XMJMFFHXWPCBPN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|