C28H22N2O4 — CID 142491760
2-amino-9-ethyl-4-[4-(3-methoxyphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491760) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-amino-9-ethyl-4-[4-(3-methoxyphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-9-ethyl-4-[4-(3-methoxyphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491760 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-amino-9-ethyl-4-[4-(3-methoxyphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | CCc1ccc2oc(=O)c3c(c2c1)OC(N)=C(C#N)C3c1ccc(-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C28H22N2O4/c1-3-16-7-12-23-21(13-16)26-25(28(31)33-23)24(22(15-29)27(30)34-26)18-10-8-17(9-11-18)19-5-4-6-20(14-19)32-2/h4-14,24H,3,30H2,1-2H3 |
| InChIKey | FCLTYEPSDRXJJA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|