C26H17Cl2N3O3 — CID 142491879
2-amino-4-[4-(4,6-dichloro-3-pyridinyl)phenyl]-9-ethyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491879) has the molecular formula C26H17Cl2N3O3 and a molecular weight of 490.35 g/mol. Its IUPAC name is 2-amino-4-[4-(4,6-dichloro-3-pyridinyl)phenyl]-9-ethyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-[4-(4,6-dichloro-3-pyridinyl)phenyl]-9-ethyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491879 |
| Molecular Formula | C26H17Cl2N3O3 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 2-amino-4-[4-(4,6-dichloro-3-pyridinyl)phenyl]-9-ethyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | CCc1ccc2oc(=O)c3c(c2c1)OC(N)=C(C#N)C3c1ccc(-c2cnc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H17Cl2N3O3/c1-2-13-3-8-20-16(9-13)24-23(26(32)33-20)22(17(11-29)25(30)34-24)15-6-4-14(5-7-15)18-12-31-21(28)10-19(18)27/h3-10,12,22H,2,30H2,1H3 |
| InChIKey | NBHTXEGHKAOQOH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|