C27H20FN3O3 — CID 142491731
2-amino-9-ethyl-4-[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491731) has the molecular formula C27H20FN3O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 2-amino-9-ethyl-4-[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-9-ethyl-4-[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491731 |
| Molecular Formula | C27H20FN3O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-amino-9-ethyl-4-[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | CCc1ccc2oc(=O)c3c(c2c1)OC(N)=C(C#N)C3c1ccc(-c2cnc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C27H20FN3O3/c1-3-15-4-9-21-19(11-15)24-23(27(32)33-21)22(20(12-29)26(30)34-24)17-7-5-16(6-8-17)18-10-14(2)25(28)31-13-18/h4-11,13,22H,3,30H2,1-2H3 |
| InChIKey | PGBRQEVWNUKSMF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|