C26H17FN2O3 — CID 142491734
2-amino-9-fluoro-4-[4-(2-methylphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491734) has the molecular formula C26H17FN2O3 and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-amino-9-fluoro-4-[4-(2-methylphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-9-fluoro-4-[4-(2-methylphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491734 |
| Molecular Formula | C26H17FN2O3 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-amino-9-fluoro-4-[4-(2-methylphenyl)phenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | Cc1ccccc1-c1ccc(C2C(C#N)=C(N)Oc3c2c(=O)oc2ccc(F)cc32)cc1 |
| InChI | InChI=1S/C26H17FN2O3/c1-14-4-2-3-5-18(14)15-6-8-16(9-7-15)22-20(13-28)25(29)32-24-19-12-17(27)10-11-21(19)31-26(30)23(22)24/h2-12,22H,29H2,1H3 |
| InChIKey | LXJVPXBRFCWZBU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|