C24H16N4O4 — CID 142491782
2-amino-8-methoxy-5-oxo-4-(4-pyrimidin-5-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 142491782) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-amino-8-methoxy-5-oxo-4-(4-pyrimidin-5-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-8-methoxy-5-oxo-4-(4-pyrimidin-5-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 142491782 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-amino-8-methoxy-5-oxo-4-(4-pyrimidin-5-ylphenyl)-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)C(c1ccc(-c2cncnc2)cc1)C(C#N)=C(N)O3 |
| InChI | InChI=1S/C24H16N4O4/c1-30-16-6-7-17-19(8-16)31-24(29)21-20(18(9-25)23(26)32-22(17)21)14-4-2-13(3-5-14)15-10-27-12-28-11-15/h2-8,10-12,20H,26H2,1H3 |
| InChIKey | RBNWQKGOUMOOBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|