C21H18BrN3O4 — CID 158420909
2,9-diamino-4-(3-bromo-4-methoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile;methane (PubChem CID 158420909) has the molecular formula C21H18BrN3O4 and a molecular weight of 456.30 g/mol. Its IUPAC name is 2,9-diamino-4-(3-bromo-4-methoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile;methane.
| Compound Name | 2,9-diamino-4-(3-bromo-4-methoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile;methane |
|---|---|
| PubChem CID | 158420909 |
| Molecular Formula | C21H18BrN3O4 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2,9-diamino-4-(3-bromo-4-methoxyphenyl)-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile;methane |
| SMILES | C.COc1ccc(C2C(C#N)=C(N)Oc3c2c(=O)oc2ccc(N)cc32)cc1Br |
| InChI | InChI=1S/C20H14BrN3O4.CH4/c1-26-15-4-2-9(6-13(15)21)16-12(8-22)19(24)28-18-11-7-10(23)3-5-14(11)27-20(25)17(16)18;/h2-7,16H,23-24H2,1H3;1H4 |
| InChIKey | HAMCFHVOTSSGRA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|