C24H18N2O7 — CID 100998992
4-amino-11,17-dimethoxy-6-(4-methoxyphenyl)-8-oxo-3,9,13-trioxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),4,10,12(16),14-hexaene-5-carbonitrile (PubChem CID 100998992) has the molecular formula C24H18N2O7 and a molecular weight of 446.42 g/mol. Its IUPAC name is 4-amino-11,17-dimethoxy-6-(4-methoxyphenyl)-8-oxo-3,9,13-trioxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),4,10,12(16),14-hexaene-5-carbonitrile.
| Compound Name | 4-amino-11,17-dimethoxy-6-(4-methoxyphenyl)-8-oxo-3,9,13-trioxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),4,10,12(16),14-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 100998992 |
| Molecular Formula | C24H18N2O7 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-amino-11,17-dimethoxy-6-(4-methoxyphenyl)-8-oxo-3,9,13-trioxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),4,10,12(16),14-hexaene-5-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3c2c(=O)oc2c(OC)c4occc4c(OC)c32)cc1 |
| InChI | InChI=1S/C24H18N2O7/c1-28-12-6-4-11(5-7-12)15-14(10-25)23(26)32-20-16(15)24(27)33-21-17(20)18(29-2)13-8-9-31-19(13)22(21)30-3/h4-9,15H,26H2,1-3H3 |
| InChIKey | AAPWBUMSVKECHF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|