C22H21N3O4 — CID 2035447
(4R)-7-hydroxy-4-(4-methoxyphenyl)-2-(morpholin-4-ylmethylideneamino)-4H-chromene-3-carbonitrile (PubChem CID 2035447) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is (4R)-7-hydroxy-4-(4-methoxyphenyl)-2-(morpholin-4-ylmethylideneamino)-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-7-hydroxy-4-(4-methoxyphenyl)-2-(morpholin-4-ylmethylideneamino)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2035447 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (4R)-7-hydroxy-4-(4-methoxyphenyl)-2-(morpholin-4-ylmethylideneamino)-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc([C@H]2C(C#N)=C(N=CN3CCOCC3)Oc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-27-17-5-2-15(3-6-17)21-18-7-4-16(26)12-20(18)29-22(19(21)13-23)24-14-25-8-10-28-11-9-25/h2-7,12,14,21,26H,8-11H2,1H3/t21-/m1/s1 |
| InChIKey | RCXOXJWQVHLLEE-OAQYLSRUSA-N |
| XLogP | 3.02 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|