C23H23N3O4 — CID 2023999
(4S)-4-(3,4-dimethoxyphenyl)-7-hydroxy-2-(pyrrolidin-1-ylmethylideneamino)-4H-chromene-3-carbonitrile (PubChem CID 2023999) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxyphenyl)-7-hydroxy-2-(pyrrolidin-1-ylmethylideneamino)-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-4-(3,4-dimethoxyphenyl)-7-hydroxy-2-(pyrrolidin-1-ylmethylideneamino)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 2023999 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (4S)-4-(3,4-dimethoxyphenyl)-7-hydroxy-2-(pyrrolidin-1-ylmethylideneamino)-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc([C@@H]2C(C#N)=C(N=CN3CCCC3)Oc3cc(O)ccc32)cc1OC |
| InChI | InChI=1S/C23H23N3O4/c1-28-19-8-5-15(11-21(19)29-2)22-17-7-6-16(27)12-20(17)30-23(18(22)13-24)25-14-26-9-3-4-10-26/h5-8,11-12,14,22,27H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
| InChIKey | BKUAQTUPTSOOAM-QFIPXVFZSA-N |
| XLogP | 3.79 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|