C25H23N5O2 — CID 4578973
3-methyl-6-(morpholin-4-ylmethylideneamino)-1,4-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 4578973) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-methyl-6-(morpholin-4-ylmethylideneamino)-1,4-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 3-methyl-6-(morpholin-4-ylmethylideneamino)-1,4-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4578973 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-methyl-6-(morpholin-4-ylmethylideneamino)-1,4-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1)C(C#N)=C(N=CN1CCOCC1)O2 |
| InChI | InChI=1S/C25H23N5O2/c1-18-22-23(19-8-4-2-5-9-19)21(16-26)24(27-17-29-12-14-31-15-13-29)32-25(22)30(28-18)20-10-6-3-7-11-20/h2-11,17,23H,12-15H2,1H3 |
| InChIKey | XFLRTVHZFMAJQK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|