C22H17FN2O2S — CID 168859829
ethyl (1E)-N-[3-cyano-4-(4-fluorophenyl)-6-methyl-4H-[1]benzothiolo[3,2-b]pyran-2-yl]methanimidate (PubChem CID 168859829) has the molecular formula C22H17FN2O2S and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl (1E)-N-[3-cyano-4-(4-fluorophenyl)-6-methyl-4H-[1]benzothiolo[3,2-b]pyran-2-yl]methanimidate.
| Compound Name | ethyl (1E)-N-[3-cyano-4-(4-fluorophenyl)-6-methyl-4H-[1]benzothiolo[3,2-b]pyran-2-yl]methanimidate |
|---|---|
| PubChem CID | 168859829 |
| Molecular Formula | C22H17FN2O2S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | ethyl (1E)-N-[3-cyano-4-(4-fluorophenyl)-6-methyl-4H-[1]benzothiolo[3,2-b]pyran-2-yl]methanimidate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2ccc(F)cc2)c2sc3c(C)cccc3c2O1 |
| InChI | InChI=1S/C22H17FN2O2S/c1-3-26-12-25-22-17(11-24)18(14-7-9-15(23)10-8-14)21-19(27-22)16-6-4-5-13(2)20(16)28-21/h4-10,12,18H,3H2,1-2H3/b25-12+ |
| InChIKey | UEQPKYGQSJBWHS-BRJLIKDPSA-N |
| XLogP | 5.67 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|