C27H16BrClN2O — CID 11827205
2-[(E)-benzylideneamino]-4-(4-bromophenyl)-6-chloro-4H-benzo[h]chromene-3-carbonitrile (PubChem CID 11827205) has the molecular formula C27H16BrClN2O and a molecular weight of 499.80 g/mol. Its IUPAC name is 2-[(E)-benzylideneamino]-4-(4-bromophenyl)-6-chloro-4H-benzo[h]chromene-3-carbonitrile.
| Compound Name | 2-[(E)-benzylideneamino]-4-(4-bromophenyl)-6-chloro-4H-benzo[h]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 11827205 |
| Molecular Formula | C27H16BrClN2O |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 2-[(E)-benzylideneamino]-4-(4-bromophenyl)-6-chloro-4H-benzo[h]chromene-3-carbonitrile |
| SMILES | N#CC1=C(/N=C/c2ccccc2)Oc2c(cc(Cl)c3ccccc23)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H16BrClN2O/c28-19-12-10-18(11-13-19)25-22-14-24(29)20-8-4-5-9-21(20)26(22)32-27(23(25)15-30)31-16-17-6-2-1-3-7-17/h1-14,16,25H/b31-16+ |
| InChIKey | XMORQAPOPQJBQO-WCMJOSRZSA-N |
| XLogP | 7.63 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|