C23H15Br2N3O2 — CID 3845004
2-amino-4-(4-bromophenyl)-6-[(4-bromophenyl)iminomethyl]-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 3845004) has the molecular formula C23H15Br2N3O2 and a molecular weight of 525.20 g/mol. Its IUPAC name is 2-amino-4-(4-bromophenyl)-6-[(4-bromophenyl)iminomethyl]-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(4-bromophenyl)-6-[(4-bromophenyl)iminomethyl]-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3845004 |
| Molecular Formula | C23H15Br2N3O2 |
| Molecular Weight | 525.20 g/mol |
| Exact Mass | 522.95 |
| IUPAC Name | 2-amino-4-(4-bromophenyl)-6-[(4-bromophenyl)iminomethyl]-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)c(/C=N/c3ccc(Br)cc3)cc2C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H15Br2N3O2/c24-15-3-1-13(2-4-15)22-18-9-14(12-28-17-7-5-16(25)6-8-17)20(29)10-21(18)30-23(27)19(22)11-26/h1-10,12,22,29H,27H2/b28-12+ |
| InChIKey | UGFYPCHXFAYJPI-KVSWJAHQSA-N |
| XLogP | 5.89 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.20 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|